Question #1f618 Precalculus 1 Answer bp Aug 26, 2015 cot#(-pi/4)=-cot(pi/4)# sec#((7pi)/6)=sec(pi+pi/6)=-sec(pi/6)# Explanation: Angle #-pi/4# is in the IVth quadrant, where cot is negative, hence cot#(-pi/4)=-cot(pi/4)# Angle#((7pi)/6)# is in the IIIrd quadrant where cosine and hence sec is negative. This makes sec#((7pi)/6)=sec(pi+pi/6)=-sec(pi/6)# Answer link Related questions How do I determine the molecular shape of a molecule? What is the lewis structure for co2? What is the lewis structure for hcn? How is vsepr used to classify molecules? What are the units used for the ideal gas law? How does Charle's law relate to breathing? What is the ideal gas law constant? How do you calculate the ideal gas law constant? How do you find density in the ideal gas law? Does ideal gas law apply to liquids? Impact of this question 1810 views around the world You can reuse this answer Creative Commons License